4-AMINO CYCLOHEXANE-L-CARBOXYLIC ACID
cis-4-Aminocyclohexanecarboxylic Acid
CAS: 3685-23-2
Molecular Formula: C7H13NO2
4-AMINO CYCLOHEXANE-L-CARBOXYLIC ACID - Names and Identifiers
| Name | cis-4-Aminocyclohexanecarboxylic Acid |
| Synonyms | cis-4-Aminocyclohexanecarboxylic Acid 4-AMINO CYCLOHEXANE-L-CARBOXYLIC ACID AminocyclohexanecarboxylicAcid,cis-4- CIS-4-AMINO-1-CYCLOHEXANECARBOXYLIC ACID (1s,4s)-4-aminocyclohexanecarboxylic acid |
| CAS | 3685-23-2 |
| EINECS | 626-259-5 |
| InChI | InChI=1/C7H13NO2/c8-6-3-1-5(2-4-6)7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6+ |
4-AMINO CYCLOHEXANE-L-CARBOXYLIC ACID - Physico-chemical Properties
| Molecular Formula | C7H13NO2 |
| Molar Mass | 143.18 |
| Density | 9 g/cm3 |
| Melting Point | 299-301°C(lit.) |
| Boling Point | 280.0±33.0 °C(Predicted) |
| Flash Point | 123.1°C |
| Water Solubility | Soluble in water |
| Vapor Presure | 0.00103mmHg at 25°C |
| Appearance | Powder |
| Color | Off-white |
| pKa | 4.62±0.25(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.503 |
4-AMINO CYCLOHEXANE-L-CARBOXYLIC ACID - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Hazard Class | IRRITANT |
4-AMINO CYCLOHEXANE-L-CARBOXYLIC ACID - Introduction
cis-4-Aminocyclohexanecarboxylic Acid, also known as cis-4-Aminocyclohexanecarboxylic Acid, is an organic compound. The following is an introduction to the nature, use, formulation and safety information of cis-4-Aminocyclohexanecarboxylic Acid:
Nature:
1. Chemical formula: C7H13NO2
2. molecular weight: 143.18g/mol
3. Appearance: colorless or white solid
4. melting point: 165-167 ℃
5. Solubility: Soluble in water and most organic solvents
6. It is a chiral compound. Due to the presence of amino and carboxyl groups in the molecule, it will form two configurations, namely cis and trans.
Use:
cis-4-Aminocyclohexanecarboxylic Acid has a wide range of applications in the field of medicine:
1. As synthetic drugs and drug intermediates, used in the production of antibiotics, anti-cancer drugs and antidepressants.
2. used as a raw material for the synthesis of α-amino acids for the synthesis of pituitary hormones, neurotransmitters and peptide compounds.
Preparation Method:
The preparation method of cis-4-Aminocyclohexanecarboxylic Acid can be carried out by the following steps:
1. First, cyclohexene reacts with nitric oxide to generate cyclohexene -1-oxygen compound.
2. Next, the cyclohexene-1-oxy compound is reacted with ammonia gas to obtain a 4-aminocyclohexene-1-oxy compound.
3. Finally, the 4-aminocyclohexene-1-oxy compound is oxidized to the cis-4-Aminocyclohexanecarboxylic Acid.
Safety Information:
1. cis-4-Aminocyclohexanecarboxylic Acid belongs to organic compounds, should pay attention to protective measures, avoid inhalation, intake and skin contact.
2. When handling, storing and transporting cis-4-Aminocyclohexanecarboxylic Acid, the container should be sealed away from ignition and oxidizing agents.
3. if ingestion or accidental contact with eyes or skin, should immediately rinse with plenty of water, and seek medical advice.
4. When handling cis-4-Aminocyclohexanecarboxylic Acid, follow safety procedures and wear appropriate protective equipment, such as lab gloves and goggles.
Please note that this is only general information, please refer to the relevant scientific literature and safety data for specific use and operation.
Nature:
1. Chemical formula: C7H13NO2
2. molecular weight: 143.18g/mol
3. Appearance: colorless or white solid
4. melting point: 165-167 ℃
5. Solubility: Soluble in water and most organic solvents
6. It is a chiral compound. Due to the presence of amino and carboxyl groups in the molecule, it will form two configurations, namely cis and trans.
Use:
cis-4-Aminocyclohexanecarboxylic Acid has a wide range of applications in the field of medicine:
1. As synthetic drugs and drug intermediates, used in the production of antibiotics, anti-cancer drugs and antidepressants.
2. used as a raw material for the synthesis of α-amino acids for the synthesis of pituitary hormones, neurotransmitters and peptide compounds.
Preparation Method:
The preparation method of cis-4-Aminocyclohexanecarboxylic Acid can be carried out by the following steps:
1. First, cyclohexene reacts with nitric oxide to generate cyclohexene -1-oxygen compound.
2. Next, the cyclohexene-1-oxy compound is reacted with ammonia gas to obtain a 4-aminocyclohexene-1-oxy compound.
3. Finally, the 4-aminocyclohexene-1-oxy compound is oxidized to the cis-4-Aminocyclohexanecarboxylic Acid.
Safety Information:
1. cis-4-Aminocyclohexanecarboxylic Acid belongs to organic compounds, should pay attention to protective measures, avoid inhalation, intake and skin contact.
2. When handling, storing and transporting cis-4-Aminocyclohexanecarboxylic Acid, the container should be sealed away from ignition and oxidizing agents.
3. if ingestion or accidental contact with eyes or skin, should immediately rinse with plenty of water, and seek medical advice.
4. When handling cis-4-Aminocyclohexanecarboxylic Acid, follow safety procedures and wear appropriate protective equipment, such as lab gloves and goggles.
Please note that this is only general information, please refer to the relevant scientific literature and safety data for specific use and operation.
Last Update：2024-04-09 21:04:16
